C22H44FO3Si+ — CID 91017297
[4-fluoro-1-[(1R)-2-[(Z)-hept-2-enyl]-3,5-dihydroxycyclopentyl]octan-3-yl]oxy-dimethylsilanylium (PubChem CID 91017297) has the molecular formula C22H44FO3Si+ and a molecular weight of 403.68 g/mol. Its IUPAC name is [4-fluoro-1-[(1R)-2-[(Z)-hept-2-enyl]-3,5-dihydroxycyclopentyl]octan-3-yl]oxy-dimethylsilanylium.
| Compound Name | [4-fluoro-1-[(1R)-2-[(Z)-hept-2-enyl]-3,5-dihydroxycyclopentyl]octan-3-yl]oxy-dimethylsilanylium |
|---|---|
| PubChem CID | 91017297 |
| Molecular Formula | C22H44FO3Si+ |
| Molecular Weight | 403.68 g/mol |
| Exact Mass | 403.30 |
| IUPAC Name | [4-fluoro-1-[(1R)-2-[(Z)-hept-2-enyl]-3,5-dihydroxycyclopentyl]octan-3-yl]oxy-dimethylsilanylium |
| SMILES | CCCC/C=C\CC1C(O)CC(O)[C@@H]1CCC(O[SiH2+](C)C)C(F)CCCC |
| InChI | InChI=1S/C22H44FO3Si/c1-5-7-9-10-11-12-17-18(21(25)16-20(17)24)14-15-22(26-27(3)4)19(23)13-8-6-2/h10-11,17-22,24-25H,5-9,12-16,27H2,1-4H3/q+1/b11-10-/t17?,18-,19?,20?,21?,22?/m1/s1 |
| InChIKey | ULAYKZDEHUGXJH-CYXGNIFXSA-N |
| XLogP | 4.89 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.68 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|