C26H52O4Si — CID 134870373
(3R,4R,5R)-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-(7-hydroxyheptyl)cyclopentane-1,3-diol (PubChem CID 134870373) has the molecular formula C26H52O4Si and a molecular weight of 456.78 g/mol. Its IUPAC name is (3R,4R,5R)-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-(7-hydroxyheptyl)cyclopentane-1,3-diol.
| Compound Name | (3R,4R,5R)-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-(7-hydroxyheptyl)cyclopentane-1,3-diol |
|---|---|
| PubChem CID | 134870373 |
| Molecular Formula | C26H52O4Si |
| Molecular Weight | 456.78 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | (3R,4R,5R)-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-(7-hydroxyheptyl)cyclopentane-1,3-diol |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1[C@H](O)CC(O)[C@@H]1CCCCCCCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H52O4Si/c1-7-8-12-15-21(30-31(5,6)26(2,3)4)17-18-23-22(24(28)20-25(23)29)16-13-10-9-11-14-19-27/h17-18,21-25,27-29H,7-16,19-20H2,1-6H3/b18-17+/t21-,22+,23+,24?,25+/m0/s1 |
| InChIKey | OKLDSFCPNFKCIC-RQKRKLIJSA-N |
| XLogP | 6.20 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.78 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|