C29H56O3Si — CID 139253927
(2S,4R)-4-[(1S,3R,4R)-4-(cyclohexen-1-yl)-2,2-diethyl-3-tri(propan-2-yl)silyloxycyclopentyl]oxypentan-2-ol (PubChem CID 139253927) has the molecular formula C29H56O3Si and a molecular weight of 480.85 g/mol. Its IUPAC name is (2S,4R)-4-[(1S,3R,4R)-4-(cyclohexen-1-yl)-2,2-diethyl-3-tri(propan-2-yl)silyloxycyclopentyl]oxypentan-2-ol.
| Compound Name | (2S,4R)-4-[(1S,3R,4R)-4-(cyclohexen-1-yl)-2,2-diethyl-3-tri(propan-2-yl)silyloxycyclopentyl]oxypentan-2-ol |
|---|---|
| PubChem CID | 139253927 |
| Molecular Formula | C29H56O3Si |
| Molecular Weight | 480.85 g/mol |
| Exact Mass | 480.40 |
| IUPAC Name | (2S,4R)-4-[(1S,3R,4R)-4-(cyclohexen-1-yl)-2,2-diethyl-3-tri(propan-2-yl)silyloxycyclopentyl]oxypentan-2-ol |
| SMILES | CCC1(CC)[C@@H](O[C@H](C)C[C@H](C)O)C[C@H](C2=CCCCC2)[C@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H56O3Si/c1-11-29(12-2)27(31-24(10)18-23(9)30)19-26(25-16-14-13-15-17-25)28(29)32-33(20(3)4,21(5)6)22(7)8/h16,20-24,26-28,30H,11-15,17-19H2,1-10H3/t23-,24+,26+,27-,28+/m0/s1 |
| InChIKey | WCOODTORWUJRHJ-RDOUGGHTSA-N |
| XLogP | 8.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.85 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|