C27H52O3Si — CID 139253920
(2S,4R)-4-[(1S,3S,4S)-4-(cyclohexen-1-yl)-2,2-dimethyl-3-tri(propan-2-yl)silyloxycyclopentyl]oxypentan-2-ol (PubChem CID 139253920) has the molecular formula C27H52O3Si and a molecular weight of 452.80 g/mol. Its IUPAC name is (2S,4R)-4-[(1S,3S,4S)-4-(cyclohexen-1-yl)-2,2-dimethyl-3-tri(propan-2-yl)silyloxycyclopentyl]oxypentan-2-ol.
| Compound Name | (2S,4R)-4-[(1S,3S,4S)-4-(cyclohexen-1-yl)-2,2-dimethyl-3-tri(propan-2-yl)silyloxycyclopentyl]oxypentan-2-ol |
|---|---|
| PubChem CID | 139253920 |
| Molecular Formula | C27H52O3Si |
| Molecular Weight | 452.80 g/mol |
| Exact Mass | 452.37 |
| IUPAC Name | (2S,4R)-4-[(1S,3S,4S)-4-(cyclohexen-1-yl)-2,2-dimethyl-3-tri(propan-2-yl)silyloxycyclopentyl]oxypentan-2-ol |
| SMILES | CC(C)[Si](O[C@H]1[C@H](C2=CCCCC2)C[C@H](O[C@H](C)C[C@H](C)O)C1(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H52O3Si/c1-18(2)31(19(3)4,20(5)6)30-26-24(23-14-12-11-13-15-23)17-25(27(26,9)10)29-22(8)16-21(7)28/h14,18-22,24-26,28H,11-13,15-17H2,1-10H3/t21-,22+,24-,25-,26-/m0/s1 |
| InChIKey | UCMZRQLISVYTPT-KIRBFPCPSA-N |
| XLogP | 7.64 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.80 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|