C24H48O2Si2 — CID 44521476
(1R,3aS,7R,8S,8aS)-1-methyl-7-propan-2-yl-8-triethylsilyloxy-4-(trimethylsilylmethyl)-3,3a,6,7,8,8a-hexahydro-2H-azulen-1-ol (PubChem CID 44521476) has the molecular formula C24H48O2Si2 and a molecular weight of 424.82 g/mol. Its IUPAC name is (1R,3aS,7R,8S,8aS)-1-methyl-7-propan-2-yl-8-triethylsilyloxy-4-(trimethylsilylmethyl)-3,3a,6,7,8,8a-hexahydro-2H-azulen-1-ol.
| Compound Name | (1R,3aS,7R,8S,8aS)-1-methyl-7-propan-2-yl-8-triethylsilyloxy-4-(trimethylsilylmethyl)-3,3a,6,7,8,8a-hexahydro-2H-azulen-1-ol |
|---|---|
| PubChem CID | 44521476 |
| Molecular Formula | C24H48O2Si2 |
| Molecular Weight | 424.82 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | (1R,3aS,7R,8S,8aS)-1-methyl-7-propan-2-yl-8-triethylsilyloxy-4-(trimethylsilylmethyl)-3,3a,6,7,8,8a-hexahydro-2H-azulen-1-ol |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H]2[C@H](CC[C@@]2(C)O)C(C[Si](C)(C)C)=CC[C@@H]1C(C)C |
| InChI | InChI=1S/C24H48O2Si2/c1-10-28(11-2,12-3)26-23-20(18(4)5)14-13-19(17-27(7,8)9)21-15-16-24(6,25)22(21)23/h13,18,20-23,25H,10-12,14-17H2,1-9H3/t20-,21-,22+,23+,24-/m1/s1 |
| InChIKey | TVRWDCYSRSZSKC-URYYLNOGSA-N |
| XLogP | 7.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.82 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|