C18H34O3Si — CID 139037266
(2R)-2-[(1R,3aR,8aR)-3a-(hydroxymethyl)-6-methyl-8a-trimethylsilyloxy-1,2,3,4,7,8-hexahydroazulen-1-yl]propan-1-ol (PubChem CID 139037266) has the molecular formula C18H34O3Si and a molecular weight of 326.55 g/mol. Its IUPAC name is (2R)-2-[(1R,3aR,8aR)-3a-(hydroxymethyl)-6-methyl-8a-trimethylsilyloxy-1,2,3,4,7,8-hexahydroazulen-1-yl]propan-1-ol.
| Compound Name | (2R)-2-[(1R,3aR,8aR)-3a-(hydroxymethyl)-6-methyl-8a-trimethylsilyloxy-1,2,3,4,7,8-hexahydroazulen-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 139037266 |
| Molecular Formula | C18H34O3Si |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | (2R)-2-[(1R,3aR,8aR)-3a-(hydroxymethyl)-6-methyl-8a-trimethylsilyloxy-1,2,3,4,7,8-hexahydroazulen-1-yl]propan-1-ol |
| SMILES | CC1=CC[C@@]2(CO)CC[C@H]([C@@H](C)CO)[C@]2(O[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C18H34O3Si/c1-14-6-9-17(13-20)10-8-16(15(2)12-19)18(17,11-7-14)21-22(3,4)5/h6,15-16,19-20H,7-13H2,1-5H3/t15-,16+,17-,18+/m0/s1 |
| InChIKey | QIPLTVIJVRVIRD-XWTMOSNGSA-N |
| XLogP | 3.72 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|