C20H34O3Si — CID 11695996
(1S,2R,5S,6S,7R)-6-[tert-butyl(dimethyl)silyl]oxy-7-(hydroxymethyl)-2,5,8-trimethyltricyclo[5.3.0.02,5]deca-3,8-dien-1-ol (PubChem CID 11695996) has the molecular formula C20H34O3Si and a molecular weight of 350.58 g/mol. Its IUPAC name is (1S,2R,5S,6S,7R)-6-[tert-butyl(dimethyl)silyl]oxy-7-(hydroxymethyl)-2,5,8-trimethyltricyclo[5.3.0.02,5]deca-3,8-dien-1-ol.
| Compound Name | (1S,2R,5S,6S,7R)-6-[tert-butyl(dimethyl)silyl]oxy-7-(hydroxymethyl)-2,5,8-trimethyltricyclo[5.3.0.02,5]deca-3,8-dien-1-ol |
|---|---|
| PubChem CID | 11695996 |
| Molecular Formula | C20H34O3Si |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | (1S,2R,5S,6S,7R)-6-[tert-butyl(dimethyl)silyl]oxy-7-(hydroxymethyl)-2,5,8-trimethyltricyclo[5.3.0.02,5]deca-3,8-dien-1-ol |
| SMILES | CC1=CC[C@]2(O)[C@]3(C)C=C[C@]3(C)[C@H](O[Si](C)(C)C(C)(C)C)[C@]12CO |
| InChI | InChI=1S/C20H34O3Si/c1-14-9-10-20(22)18(6)12-11-17(18,5)15(19(14,20)13-21)23-24(7,8)16(2,3)4/h9,11-12,15,21-22H,10,13H2,1-8H3/t15-,17+,18+,19-,20-/m0/s1 |
| InChIKey | ZWQGLPUZDLVGCB-VRCPBSEVSA-N |
| XLogP | 4.03 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|