C24H44O3Si — CID 10949599
(1S,2R,3S,5S,6S,7R)-3-[8-[tert-butyl(dimethyl)silyl]oxyoctyl]tricyclo[5.2.1.02,6]dec-8-ene-3,5-diol (PubChem CID 10949599) has the molecular formula C24H44O3Si and a molecular weight of 408.70 g/mol. Its IUPAC name is (1S,2R,3S,5S,6S,7R)-3-[8-[tert-butyl(dimethyl)silyl]oxyoctyl]tricyclo[5.2.1.02,6]dec-8-ene-3,5-diol.
| Compound Name | (1S,2R,3S,5S,6S,7R)-3-[8-[tert-butyl(dimethyl)silyl]oxyoctyl]tricyclo[5.2.1.02,6]dec-8-ene-3,5-diol |
|---|---|
| PubChem CID | 10949599 |
| Molecular Formula | C24H44O3Si |
| Molecular Weight | 408.70 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | (1S,2R,3S,5S,6S,7R)-3-[8-[tert-butyl(dimethyl)silyl]oxyoctyl]tricyclo[5.2.1.02,6]dec-8-ene-3,5-diol |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCCCC[C@]1(O)C[C@H](O)[C@@H]2[C@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C24H44O3Si/c1-23(2,3)28(4,5)27-15-11-9-7-6-8-10-14-24(26)17-20(25)21-18-12-13-19(16-18)22(21)24/h12-13,18-22,25-26H,6-11,14-17H2,1-5H3/t18-,19+,20-,21+,22+,24-/m0/s1 |
| InChIKey | BSSUZWHULMFBKV-QRKRNDJXSA-N |
| XLogP | 5.67 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.70 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|