C22H36O3Si — CID 11574373
(1S,2R,5S,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-7-[(E)-2-methoxyethenyl]-2,5,8-trimethyltricyclo[5.3.0.02,5]deca-3,8-dien-1-ol (PubChem CID 11574373) has the molecular formula C22H36O3Si and a molecular weight of 376.61 g/mol. Its IUPAC name is (1S,2R,5S,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-7-[(E)-2-methoxyethenyl]-2,5,8-trimethyltricyclo[5.3.0.02,5]deca-3,8-dien-1-ol.
| Compound Name | (1S,2R,5S,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-7-[(E)-2-methoxyethenyl]-2,5,8-trimethyltricyclo[5.3.0.02,5]deca-3,8-dien-1-ol |
|---|---|
| PubChem CID | 11574373 |
| Molecular Formula | C22H36O3Si |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | (1S,2R,5S,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-7-[(E)-2-methoxyethenyl]-2,5,8-trimethyltricyclo[5.3.0.02,5]deca-3,8-dien-1-ol |
| SMILES | CO/C=C/[C@@]12C(C)=CC[C@]1(O)[C@]1(C)C=C[C@]1(C)[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H36O3Si/c1-16-10-11-22(23)20(6)13-12-19(20,5)17(21(16,22)14-15-24-7)25-26(8,9)18(2,3)4/h10,12-15,17,23H,11H2,1-9H3/b15-14+/t17-,19+,20+,21-,22-/m0/s1 |
| InChIKey | RDMIDZNMTCNKJH-WDQNMCSSSA-N |
| XLogP | 5.20 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|