C20H34O2 — CID 11044996
(1R,7S,8S,9S,12R)-7,12-dibutyltricyclo[7.2.1.01,5]dodec-5-ene-8,12-diol (PubChem CID 11044996) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (1R,7S,8S,9S,12R)-7,12-dibutyltricyclo[7.2.1.01,5]dodec-5-ene-8,12-diol.
| Compound Name | (1R,7S,8S,9S,12R)-7,12-dibutyltricyclo[7.2.1.01,5]dodec-5-ene-8,12-diol |
|---|---|
| PubChem CID | 11044996 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (1R,7S,8S,9S,12R)-7,12-dibutyltricyclo[7.2.1.01,5]dodec-5-ene-8,12-diol |
| SMILES | CCCC[C@H]1C=C2CCC[C@@]23CC[C@@H]([C@H]1O)[C@]3(O)CCCC |
| InChI | InChI=1S/C20H34O2/c1-3-5-8-15-14-16-9-7-11-19(16)13-10-17(18(15)21)20(19,22)12-6-4-2/h14-15,17-18,21-22H,3-13H2,1-2H3/t15-,17-,18-,19+,20+/m0/s1 |
| InChIKey | YZURHHMLAGCYEI-AEEMCCEDSA-N |
| XLogP | 4.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|