C20H34O4 — CID 52937079
(1R,3R,4R,6R,7S,8S,10Z,12R)-4-(hydroxymethyl)-12-[(2S)-1-hydroxypropan-2-yl]-1,8-dimethyltricyclo[9.3.0.03,7]tetradec-10-ene-6,8-diol (PubChem CID 52937079) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is (1R,3R,4R,6R,7S,8S,10Z,12R)-4-(hydroxymethyl)-12-[(2S)-1-hydroxypropan-2-yl]-1,8-dimethyltricyclo[9.3.0.03,7]tetradec-10-ene-6,8-diol.
| Compound Name | (1R,3R,4R,6R,7S,8S,10Z,12R)-4-(hydroxymethyl)-12-[(2S)-1-hydroxypropan-2-yl]-1,8-dimethyltricyclo[9.3.0.03,7]tetradec-10-ene-6,8-diol |
|---|---|
| PubChem CID | 52937079 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | (1R,3R,4R,6R,7S,8S,10Z,12R)-4-(hydroxymethyl)-12-[(2S)-1-hydroxypropan-2-yl]-1,8-dimethyltricyclo[9.3.0.03,7]tetradec-10-ene-6,8-diol |
| SMILES | C[C@H](CO)[C@H]1CC[C@]2(C)C[C@@H]3[C@H](CO)C[C@@H](O)[C@H]3[C@@](C)(O)C/C=C/12 |
| InChI | InChI=1S/C20H34O4/c1-12(10-21)14-4-6-19(2)9-15-13(11-22)8-17(23)18(15)20(3,24)7-5-16(14)19/h5,12-15,17-18,21-24H,4,6-11H2,1-3H3/b16-5-/t12-,13+,14-,15-,17-,18+,19-,20+/m1/s1 |
| InChIKey | ZRHLUTXOIYNCOW-QMDVJOKOSA-N |
| XLogP | 2.11 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|