C16H34O2 — CID 158497241
(1R,3aR,8S,8aS)-3a,6-dimethyl-1-propan-2-yl-2,3,4,7,8,8a-hexahydroazulene-1,8-diol;methane;molecular hydrogen (PubChem CID 158497241) has the molecular formula C16H34O2 and a molecular weight of 258.45 g/mol. Its IUPAC name is (1R,3aR,8S,8aS)-3a,6-dimethyl-1-propan-2-yl-2,3,4,7,8,8a-hexahydroazulene-1,8-diol;methane;molecular hydrogen.
| Compound Name | (1R,3aR,8S,8aS)-3a,6-dimethyl-1-propan-2-yl-2,3,4,7,8,8a-hexahydroazulene-1,8-diol;methane;molecular hydrogen |
|---|---|
| PubChem CID | 158497241 |
| Molecular Formula | C16H34O2 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.26 |
| IUPAC Name | (1R,3aR,8S,8aS)-3a,6-dimethyl-1-propan-2-yl-2,3,4,7,8,8a-hexahydroazulene-1,8-diol;methane;molecular hydrogen |
| SMILES | C.CC1=CC[C@@]2(C)CC[C@@](O)(C(C)C)[C@@H]2[C@@H](O)C1.[H][H].[H][H] |
| InChI | InChI=1S/C15H26O2.CH4.2H2/c1-10(2)15(17)8-7-14(4)6-5-11(3)9-12(16)13(14)15;;;/h5,10,12-13,16-17H,6-9H2,1-4H3;1H4;2*1H/t12-,13+,14-,15+;;;/m0.../s1 |
| InChIKey | HJLHEIILSCZWCC-PZMYWKKGSA-N |
| XLogP | 4.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|