C16H28O2 — CID 58766321
(1R,3aR,8S,8aS)-3a,6,8a-trimethyl-1-propan-2-yl-3,4,7,8-tetrahydro-2H-azulene-1,8-diol (PubChem CID 58766321) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is (1R,3aR,8S,8aS)-3a,6,8a-trimethyl-1-propan-2-yl-3,4,7,8-tetrahydro-2H-azulene-1,8-diol.
| Compound Name | (1R,3aR,8S,8aS)-3a,6,8a-trimethyl-1-propan-2-yl-3,4,7,8-tetrahydro-2H-azulene-1,8-diol |
|---|---|
| PubChem CID | 58766321 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (1R,3aR,8S,8aS)-3a,6,8a-trimethyl-1-propan-2-yl-3,4,7,8-tetrahydro-2H-azulene-1,8-diol |
| SMILES | CC1=CC[C@@]2(C)CC[C@@](O)(C(C)C)[C@]2(C)[C@@H](O)C1 |
| InChI | InChI=1S/C16H28O2/c1-11(2)16(18)9-8-14(4)7-6-12(3)10-13(17)15(14,16)5/h6,11,13,17-18H,7-10H2,1-5H3/t13-,14-,15+,16+/m0/s1 |
| InChIKey | XRBBUWKFQHUSMI-CAOSSQGBSA-N |
| XLogP | 3.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|