C25H48O3Si2 — CID 24750020
(3S,3aS)-3-[(1R)-1-triethylsilyloxyethyl]-6-(triethylsilyloxymethyl)-2,3,4,5-tetrahydro-1H-azulen-3a-ol (PubChem CID 24750020) has the molecular formula C25H48O3Si2 and a molecular weight of 452.83 g/mol. Its IUPAC name is (3S,3aS)-3-[(1R)-1-triethylsilyloxyethyl]-6-(triethylsilyloxymethyl)-2,3,4,5-tetrahydro-1H-azulen-3a-ol.
| Compound Name | (3S,3aS)-3-[(1R)-1-triethylsilyloxyethyl]-6-(triethylsilyloxymethyl)-2,3,4,5-tetrahydro-1H-azulen-3a-ol |
|---|---|
| PubChem CID | 24750020 |
| Molecular Formula | C25H48O3Si2 |
| Molecular Weight | 452.83 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | (3S,3aS)-3-[(1R)-1-triethylsilyloxyethyl]-6-(triethylsilyloxymethyl)-2,3,4,5-tetrahydro-1H-azulen-3a-ol |
| SMILES | CC[Si](CC)(CC)OCC1=CC=C2CC[C@@H]([C@@H](C)O[Si](CC)(CC)CC)[C@@]2(O)CC1 |
| InChI | InChI=1S/C25H48O3Si2/c1-8-29(9-2,10-3)27-20-22-14-15-23-16-17-24(25(23,26)19-18-22)21(7)28-30(11-4,12-5)13-6/h14-15,21,24,26H,8-13,16-20H2,1-7H3/t21-,24+,25-/m1/s1 |
| InChIKey | DOJHCAMWNDLDRL-IEZKXTBUSA-N |
| XLogP | 7.21 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.83 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|