C22H38O3Si — CID 135073920
(4S,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-8-ethenyl-7-[(1S)-1-hydroxyprop-2-enyl]-1,5,6-trimethylbicyclo[3.2.1]oct-2-en-6-ol (PubChem CID 135073920) has the molecular formula C22H38O3Si and a molecular weight of 378.63 g/mol. Its IUPAC name is (4S,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-8-ethenyl-7-[(1S)-1-hydroxyprop-2-enyl]-1,5,6-trimethylbicyclo[3.2.1]oct-2-en-6-ol.
| Compound Name | (4S,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-8-ethenyl-7-[(1S)-1-hydroxyprop-2-enyl]-1,5,6-trimethylbicyclo[3.2.1]oct-2-en-6-ol |
|---|---|
| PubChem CID | 135073920 |
| Molecular Formula | C22H38O3Si |
| Molecular Weight | 378.63 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | (4S,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-8-ethenyl-7-[(1S)-1-hydroxyprop-2-enyl]-1,5,6-trimethylbicyclo[3.2.1]oct-2-en-6-ol |
| SMILES | C=CC1C2(C)C=C[C@H](O[Si](C)(C)C(C)(C)C)C1(C)[C@](C)(O)[C@@H]2[C@@H](O)C=C |
| InChI | InChI=1S/C22H38O3Si/c1-11-15(23)18-20(6)14-13-17(25-26(9,10)19(3,4)5)21(7,16(20)12-2)22(18,8)24/h11-18,23-24H,1-2H2,3-10H3/t15-,16?,17-,18+,20?,21?,22+/m0/s1 |
| InChIKey | QDRLTMWKRBSBHG-UDIXGBQYSA-N |
| XLogP | 4.69 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|