C26H46O3Si — CID 134865611
(1S,3R,3aR,5aR,8S)-1-[tert-butyl(dimethyl)silyl]oxy-9-(hydroxymethyl)-3a,5a-dimethyl-3-propan-2-yl-1,2,3,4,5,6,7,8-octahydrobenzo[f]azulen-8-ol (PubChem CID 134865611) has the molecular formula C26H46O3Si and a molecular weight of 434.74 g/mol. Its IUPAC name is (1S,3R,3aR,5aR,8S)-1-[tert-butyl(dimethyl)silyl]oxy-9-(hydroxymethyl)-3a,5a-dimethyl-3-propan-2-yl-1,2,3,4,5,6,7,8-octahydrobenzo[f]azulen-8-ol.
| Compound Name | (1S,3R,3aR,5aR,8S)-1-[tert-butyl(dimethyl)silyl]oxy-9-(hydroxymethyl)-3a,5a-dimethyl-3-propan-2-yl-1,2,3,4,5,6,7,8-octahydrobenzo[f]azulen-8-ol |
|---|---|
| PubChem CID | 134865611 |
| Molecular Formula | C26H46O3Si |
| Molecular Weight | 434.74 g/mol |
| Exact Mass | 434.32 |
| IUPAC Name | (1S,3R,3aR,5aR,8S)-1-[tert-butyl(dimethyl)silyl]oxy-9-(hydroxymethyl)-3a,5a-dimethyl-3-propan-2-yl-1,2,3,4,5,6,7,8-octahydrobenzo[f]azulen-8-ol |
| SMILES | CC(C)[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)C2=CC3=C(CO)[C@@H](O)CC[C@@]3(C)CC[C@@]21C |
| InChI | InChI=1S/C26H46O3Si/c1-17(2)19-15-23(29-30(8,9)24(3,4)5)21-14-20-18(16-27)22(28)10-11-25(20,6)12-13-26(19,21)7/h14,17,19,22-23,27-28H,10-13,15-16H2,1-9H3/t19-,22+,23+,25+,26-/m1/s1 |
| InChIKey | BMPSQGACSPVFOV-PELAKEKESA-N |
| XLogP | 6.23 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.74 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|