C19H42O3Si3 — CID 5374905
[(E)-3-[2-ethyl-3,5-bis(trimethylsilyloxy)cyclopentyl]prop-2-enoxy]-trimethylsilane (PubChem CID 5374905) has the molecular formula C19H42O3Si3 and a molecular weight of 402.80 g/mol. Its IUPAC name is [(E)-3-[2-ethyl-3,5-bis(trimethylsilyloxy)cyclopentyl]prop-2-enoxy]-trimethylsilane.
| Compound Name | [(E)-3-[2-ethyl-3,5-bis(trimethylsilyloxy)cyclopentyl]prop-2-enoxy]-trimethylsilane |
|---|---|
| PubChem CID | 5374905 |
| Molecular Formula | C19H42O3Si3 |
| Molecular Weight | 402.80 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | [(E)-3-[2-ethyl-3,5-bis(trimethylsilyloxy)cyclopentyl]prop-2-enoxy]-trimethylsilane |
| SMILES | CCC1C(O[Si](C)(C)C)CC(O[Si](C)(C)C)C1/C=C/CO[Si](C)(C)C |
| InChI | InChI=1S/C19H42O3Si3/c1-11-16-17(13-12-14-20-23(2,3)4)19(22-25(8,9)10)15-18(16)21-24(5,6)7/h12-13,16-19H,11,14-15H2,1-10H3/b13-12+ |
| InChIKey | PLWCBLDBSULCJT-OUKQBFOZSA-N |
| XLogP | 5.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.80 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|