C41H78O5Si3 — CID 164667814
methyl (Z)-6-[(1S,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(1E,5Z,8Z)-3-[tert-butyl(dimethyl)silyl]oxyundeca-1,5,8-trienyl]cyclopentyl]hex-4-enoate (PubChem CID 164667814) has the molecular formula C41H78O5Si3 and a molecular weight of 735.33 g/mol. Its IUPAC name is methyl (Z)-6-[(1S,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(1E,5Z,8Z)-3-[tert-butyl(dimethyl)silyl]oxyundeca-1,5,8-trienyl]cyclopentyl]hex-4-enoate.
| Compound Name | methyl (Z)-6-[(1S,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(1E,5Z,8Z)-3-[tert-butyl(dimethyl)silyl]oxyundeca-1,5,8-trienyl]cyclopentyl]hex-4-enoate |
|---|---|
| PubChem CID | 164667814 |
| Molecular Formula | C41H78O5Si3 |
| Molecular Weight | 735.33 g/mol |
| Exact Mass | 734.52 |
| IUPAC Name | methyl (Z)-6-[(1S,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(1E,5Z,8Z)-3-[tert-butyl(dimethyl)silyl]oxyundeca-1,5,8-trienyl]cyclopentyl]hex-4-enoate |
| SMILES | CC/C=C\C/C=C\CC(/C=C/[C@@H]1[C@H](C/C=C\CCC(=O)OC)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C41H78O5Si3/c1-18-19-20-21-22-24-27-33(44-47(12,13)39(2,3)4)30-31-35-34(28-25-23-26-29-38(42)43-11)36(45-48(14,15)40(5,6)7)32-37(35)46-49(16,17)41(8,9)10/h19-20,22-25,30-31,33-37H,18,21,26-29,32H2,1-17H3/b20-19-,24-22-,25-23-,31-30+/t33?,34-,35+,36-,37+/m0/s1 |
| InChIKey | QCXIKYXMLPUUJB-VFAWNKBHSA-N |
| XLogP | 12.55 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.33 |
| LogP ≤ 5 | 12.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|