C29H56O5Si3 — CID 91746945
trimethylsilyl (Z)-7-[(1R,2R,3R,5S)-2-[(E)-3-oxooct-1-enyl]-3,5-bis(trimethylsilyloxy)cyclopentyl]hept-5-enoate (PubChem CID 91746945) has the molecular formula C29H56O5Si3 and a molecular weight of 569.02 g/mol. Its IUPAC name is trimethylsilyl (Z)-7-[(1R,2R,3R,5S)-2-[(E)-3-oxooct-1-enyl]-3,5-bis(trimethylsilyloxy)cyclopentyl]hept-5-enoate.
| Compound Name | trimethylsilyl (Z)-7-[(1R,2R,3R,5S)-2-[(E)-3-oxooct-1-enyl]-3,5-bis(trimethylsilyloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 91746945 |
| Molecular Formula | C29H56O5Si3 |
| Molecular Weight | 569.02 g/mol |
| Exact Mass | 568.34 |
| IUPAC Name | trimethylsilyl (Z)-7-[(1R,2R,3R,5S)-2-[(E)-3-oxooct-1-enyl]-3,5-bis(trimethylsilyloxy)cyclopentyl]hept-5-enoate |
| SMILES | CCCCCC(=O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C29H56O5Si3/c1-11-12-15-18-24(30)21-22-26-25(19-16-13-14-17-20-29(31)34-37(8,9)10)27(32-35(2,3)4)23-28(26)33-36(5,6)7/h13,16,21-22,25-28H,11-12,14-15,17-20,23H2,1-10H3/b16-13-,22-21+/t25-,26-,27+,28-/m1/s1 |
| InChIKey | JHOIKLPEMYVKBD-GBGRQGGVSA-N |
| XLogP | 8.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.02 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|