C24H50O3Si2 — CID 603386
[2-(7-methoxyheptyl)-3-(3-methylbut-2-enyl)-4-trimethylsilyloxycyclopentyl]oxy-trimethylsilane (PubChem CID 603386) has the molecular formula C24H50O3Si2 and a molecular weight of 442.83 g/mol. Its IUPAC name is [2-(7-methoxyheptyl)-3-(3-methylbut-2-enyl)-4-trimethylsilyloxycyclopentyl]oxy-trimethylsilane.
| Compound Name | [2-(7-methoxyheptyl)-3-(3-methylbut-2-enyl)-4-trimethylsilyloxycyclopentyl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 603386 |
| Molecular Formula | C24H50O3Si2 |
| Molecular Weight | 442.83 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | [2-(7-methoxyheptyl)-3-(3-methylbut-2-enyl)-4-trimethylsilyloxycyclopentyl]oxy-trimethylsilane |
| SMILES | COCCCCCCCC1C(O[Si](C)(C)C)CC(O[Si](C)(C)C)C1CC=C(C)C |
| InChI | InChI=1S/C24H50O3Si2/c1-20(2)16-17-22-21(15-13-11-10-12-14-18-25-3)23(26-28(4,5)6)19-24(22)27-29(7,8)9/h16,21-24H,10-15,17-19H2,1-9H3 |
| InChIKey | SHOTZLWVOOVCPH-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.83 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|