C21H42OSi — CID 58918223
[(1S,2R,3S,4R)-2-[(Z)-hept-2-enyl]-4-methyl-3-(3-methylbutyl)cyclopentyl]oxy-trimethylsilane (PubChem CID 58918223) has the molecular formula C21H42OSi and a molecular weight of 338.65 g/mol. Its IUPAC name is [(1S,2R,3S,4R)-2-[(Z)-hept-2-enyl]-4-methyl-3-(3-methylbutyl)cyclopentyl]oxy-trimethylsilane.
| Compound Name | [(1S,2R,3S,4R)-2-[(Z)-hept-2-enyl]-4-methyl-3-(3-methylbutyl)cyclopentyl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 58918223 |
| Molecular Formula | C21H42OSi |
| Molecular Weight | 338.65 g/mol |
| Exact Mass | 338.30 |
| IUPAC Name | [(1S,2R,3S,4R)-2-[(Z)-hept-2-enyl]-4-methyl-3-(3-methylbutyl)cyclopentyl]oxy-trimethylsilane |
| SMILES | CCCC/C=C\C[C@@H]1[C@@H](CCC(C)C)[C@H](C)C[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C21H42OSi/c1-8-9-10-11-12-13-20-19(15-14-17(2)3)18(4)16-21(20)22-23(5,6)7/h11-12,17-21H,8-10,13-16H2,1-7H3/b12-11-/t18-,19+,20-,21+/m1/s1 |
| InChIKey | VHXLNWJJJHUWME-JLYVJYITSA-N |
| XLogP | 7.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.65 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|