C20H36OSi — CID 101409487
[(1R,3S,3aS,8aR)-1,3-bis(ethenyl)-1,2,3,3a,4,5,6,7,8,8a-decahydroazulen-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 101409487) has the molecular formula C20H36OSi and a molecular weight of 320.59 g/mol. Its IUPAC name is [(1R,3S,3aS,8aR)-1,3-bis(ethenyl)-1,2,3,3a,4,5,6,7,8,8a-decahydroazulen-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,3S,3aS,8aR)-1,3-bis(ethenyl)-1,2,3,3a,4,5,6,7,8,8a-decahydroazulen-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101409487 |
| Molecular Formula | C20H36OSi |
| Molecular Weight | 320.59 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | [(1R,3S,3aS,8aR)-1,3-bis(ethenyl)-1,2,3,3a,4,5,6,7,8,8a-decahydroazulen-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C[C@@H]1C(O[Si](C)(C)C(C)(C)C)[C@H](C=C)[C@@H]2CCCCC[C@@H]21 |
| InChI | InChI=1S/C20H36OSi/c1-8-15-17-13-11-10-12-14-18(17)16(9-2)19(15)21-22(6,7)20(3,4)5/h8-9,15-19H,1-2,10-14H2,3-7H3/t15-,16+,17+,18-,19? |
| InChIKey | DKIHTJSPCMSCAX-TWHOJGMMSA-N |
| XLogP | 6.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.59 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|