C18H32OSi — CID 15855617
[(2S,3aS,4R,8aS)-2-ethenyl-1,2,3,3a,4,5,6,8a-octahydroazulen-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 15855617) has the molecular formula C18H32OSi and a molecular weight of 292.54 g/mol. Its IUPAC name is [(2S,3aS,4R,8aS)-2-ethenyl-1,2,3,3a,4,5,6,8a-octahydroazulen-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,3aS,4R,8aS)-2-ethenyl-1,2,3,3a,4,5,6,8a-octahydroazulen-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 15855617 |
| Molecular Formula | C18H32OSi |
| Molecular Weight | 292.54 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | [(2S,3aS,4R,8aS)-2-ethenyl-1,2,3,3a,4,5,6,8a-octahydroazulen-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C[C@@H]1C[C@H]2[C@H](C=CCC[C@H]2O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C18H32OSi/c1-7-14-12-15-10-8-9-11-17(16(15)13-14)19-20(5,6)18(2,3)4/h7-8,10,14-17H,1,9,11-13H2,2-6H3/t14-,15+,16-,17+/m0/s1 |
| InChIKey | ISPZDKHFXULSRY-VVLHAWIVSA-N |
| XLogP | 5.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|