C16H30OSi — CID 14608166
[(E)-3-[(1R,2R)-4,4-dimethyl-2-(oxiran-2-ylmethyl)cyclopentyl]prop-2-enyl]-trimethylsilane (PubChem CID 14608166) has the molecular formula C16H30OSi and a molecular weight of 266.50 g/mol. Its IUPAC name is [(E)-3-[(1R,2R)-4,4-dimethyl-2-(oxiran-2-ylmethyl)cyclopentyl]prop-2-enyl]-trimethylsilane.
| Compound Name | [(E)-3-[(1R,2R)-4,4-dimethyl-2-(oxiran-2-ylmethyl)cyclopentyl]prop-2-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 14608166 |
| Molecular Formula | C16H30OSi |
| Molecular Weight | 266.50 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | [(E)-3-[(1R,2R)-4,4-dimethyl-2-(oxiran-2-ylmethyl)cyclopentyl]prop-2-enyl]-trimethylsilane |
| SMILES | CC1(C)C[C@H](CC2CO2)[C@H](/C=C/C[Si](C)(C)C)C1 |
| InChI | InChI=1S/C16H30OSi/c1-16(2)10-13(7-6-8-18(3,4)5)14(11-16)9-15-12-17-15/h6-7,13-15H,8-12H2,1-5H3/b7-6+/t13-,14+,15?/m1/s1 |
| InChIKey | KQOMAAQRHVREQT-QEAIVTKASA-N |
| XLogP | 4.72 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|