C17H30OSi — CID 10891205
[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]but-3-enoxy]-tert-butyl-dimethylsilane (PubChem CID 10891205) has the molecular formula C17H30OSi and a molecular weight of 278.51 g/mol. Its IUPAC name is [(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]but-3-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]but-3-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10891205 |
| Molecular Formula | C17H30OSi |
| Molecular Weight | 278.51 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | [(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]but-3-enoxy]-tert-butyl-dimethylsilane |
| SMILES | C=CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C17H30OSi/c1-7-8-16(18-19(5,6)17(2,3)4)15-12-13-9-10-14(15)11-13/h7,9-10,13-16H,1,8,11-12H2,2-6H3/t13-,14+,15-,16+/m0/s1 |
| InChIKey | BPQBNZGENSLRAA-XUWVNRHRSA-N |
| XLogP | 5.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|