C13H20OSi — CID 639624
trimethyl-[[(1S,2R,6R,7R)-8-tricyclo[5.2.1.02,6]deca-3,8-dienyl]oxy]silane (PubChem CID 639624) has the molecular formula C13H20OSi and a molecular weight of 220.39 g/mol. Its IUPAC name is trimethyl-[[(1S,2R,6R,7R)-8-tricyclo[5.2.1.02,6]deca-3,8-dienyl]oxy]silane.
| Compound Name | trimethyl-[[(1S,2R,6R,7R)-8-tricyclo[5.2.1.02,6]deca-3,8-dienyl]oxy]silane |
|---|---|
| PubChem CID | 639624 |
| Molecular Formula | C13H20OSi |
| Molecular Weight | 220.39 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | trimethyl-[[(1S,2R,6R,7R)-8-tricyclo[5.2.1.02,6]deca-3,8-dienyl]oxy]silane |
| SMILES | C[Si](C)(C)OC1=C[C@H]2C[C@@H]1[C@@H]1CC=C[C@@H]12 |
| InChI | InChI=1S/C13H20OSi/c1-15(2,3)14-13-8-9-7-12(13)11-6-4-5-10(9)11/h4-5,8-12H,6-7H2,1-3H3/t9-,10-,11-,12-/m1/s1 |
| InChIKey | RAEZPNZWVXMPLJ-DDHJBXDOSA-N |
| XLogP | 3.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|