C13H21F3OSi — CID 22320028
[2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1-trifluoropropan-2-yl]oxy-trimethylsilane (PubChem CID 22320028) has the molecular formula C13H21F3OSi and a molecular weight of 278.39 g/mol. Its IUPAC name is [2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1-trifluoropropan-2-yl]oxy-trimethylsilane.
| Compound Name | [2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1-trifluoropropan-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 22320028 |
| Molecular Formula | C13H21F3OSi |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | [2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1-trifluoropropan-2-yl]oxy-trimethylsilane |
| SMILES | CC(O[Si](C)(C)C)(C1CC2C=CC1C2)C(F)(F)F |
| InChI | InChI=1S/C13H21F3OSi/c1-12(13(14,15)16,17-18(2,3)4)11-8-9-5-6-10(11)7-9/h5-6,9-11H,7-8H2,1-4H3 |
| InChIKey | UQRKUFHGRHRZDU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|