C21H42O2Si2 — CID 85362869
tert-butyl-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-bicyclo[2.2.1]hept-5-enyl]methoxy]-dimethylsilane (PubChem CID 85362869) has the molecular formula C21H42O2Si2 and a molecular weight of 382.74 g/mol. Its IUPAC name is tert-butyl-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-bicyclo[2.2.1]hept-5-enyl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-bicyclo[2.2.1]hept-5-enyl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 85362869 |
| Molecular Formula | C21H42O2Si2 |
| Molecular Weight | 382.74 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | tert-butyl-[[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-bicyclo[2.2.1]hept-5-enyl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1C2C=CC(C2)C1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O2Si2/c1-20(2,3)24(7,8)22-14-18-16-11-12-17(13-16)19(18)15-23-25(9,10)21(4,5)6/h11-12,16-19H,13-15H2,1-10H3 |
| InChIKey | SQCYHCCJSARFHG-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.74 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|