C22H44O2Si — CID 11417326
[(Z)-1-[(1S,2R)-4,4-bis(methoxymethyl)-2-methylcyclopentyl]non-2-en-2-yl]-trimethylsilane (PubChem CID 11417326) has the molecular formula C22H44O2Si and a molecular weight of 368.68 g/mol. Its IUPAC name is [(Z)-1-[(1S,2R)-4,4-bis(methoxymethyl)-2-methylcyclopentyl]non-2-en-2-yl]-trimethylsilane.
| Compound Name | [(Z)-1-[(1S,2R)-4,4-bis(methoxymethyl)-2-methylcyclopentyl]non-2-en-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 11417326 |
| Molecular Formula | C22H44O2Si |
| Molecular Weight | 368.68 g/mol |
| Exact Mass | 368.31 |
| IUPAC Name | [(Z)-1-[(1S,2R)-4,4-bis(methoxymethyl)-2-methylcyclopentyl]non-2-en-2-yl]-trimethylsilane |
| SMILES | CCCCCC/C=C(/C[C@@H]1CC(COC)(COC)C[C@H]1C)[Si](C)(C)C |
| InChI | InChI=1S/C22H44O2Si/c1-8-9-10-11-12-13-21(25(5,6)7)14-20-16-22(17-23-3,18-24-4)15-19(20)2/h13,19-20H,8-12,14-18H2,1-7H3/b21-13-/t19-,20-/m1/s1 |
| InChIKey | NIQXLGFUWMRRRP-KWDXEGEASA-N |
| XLogP | 6.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.68 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|