C33H66O2Si2 — CID 11753194
[(Z)-1-[(1S,2S)-4,4-bis(methoxymethyl)-2-[(Z)-2-trimethylsilylnon-2-enyl]cyclopentyl]non-2-en-2-yl]-trimethylsilane (PubChem CID 11753194) has the molecular formula C33H66O2Si2 and a molecular weight of 551.06 g/mol. Its IUPAC name is [(Z)-1-[(1S,2S)-4,4-bis(methoxymethyl)-2-[(Z)-2-trimethylsilylnon-2-enyl]cyclopentyl]non-2-en-2-yl]-trimethylsilane.
| Compound Name | [(Z)-1-[(1S,2S)-4,4-bis(methoxymethyl)-2-[(Z)-2-trimethylsilylnon-2-enyl]cyclopentyl]non-2-en-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 11753194 |
| Molecular Formula | C33H66O2Si2 |
| Molecular Weight | 551.06 g/mol |
| Exact Mass | 550.46 |
| IUPAC Name | [(Z)-1-[(1S,2S)-4,4-bis(methoxymethyl)-2-[(Z)-2-trimethylsilylnon-2-enyl]cyclopentyl]non-2-en-2-yl]-trimethylsilane |
| SMILES | CCCCCC/C=C(/C[C@@H]1CC(COC)(COC)C[C@H]1C/C(=C/CCCCCC)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C33H66O2Si2/c1-11-13-15-17-19-21-31(36(5,6)7)23-29-25-33(27-34-3,28-35-4)26-30(29)24-32(37(8,9)10)22-20-18-16-14-12-2/h21-22,29-30H,11-20,23-28H2,1-10H3/b31-21-,32-22-/t29-,30-/m1/s1 |
| InChIKey | MVZQQHDJSDYDKC-HAGYIRHJSA-N |
| XLogP | 10.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.06 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|