C17H32O2Si — CID 142714662
[(1S,2S,3aR,7aR)-2-methoxy-2,3,3a,4,7,7a-hexahydro-1H-inden-1-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 142714662) has the molecular formula C17H32O2Si and a molecular weight of 296.53 g/mol. Its IUPAC name is [(1S,2S,3aR,7aR)-2-methoxy-2,3,3a,4,7,7a-hexahydro-1H-inden-1-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,2S,3aR,7aR)-2-methoxy-2,3,3a,4,7,7a-hexahydro-1H-inden-1-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 142714662 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | [(1S,2S,3aR,7aR)-2-methoxy-2,3,3a,4,7,7a-hexahydro-1H-inden-1-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CO[C@H]1C[C@H]2CC=CC[C@H]2[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O2Si/c1-17(2,3)20(5,6)19-12-15-14-10-8-7-9-13(14)11-16(15)18-4/h7-8,13-16H,9-12H2,1-6H3/t13-,14-,15-,16+/m1/s1 |
| InChIKey | JDAHHCPZJULXHP-FPCVCCKLSA-N |
| XLogP | 4.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|