C19H36OSi — CID 101467150
[(3aR,5S,8Z,9aR)-2,2-dimethyl-1,3,3a,4,5,6,7,9a-octahydrocyclopenta[8]annulen-5-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 101467150) has the molecular formula C19H36OSi and a molecular weight of 308.58 g/mol. Its IUPAC name is [(3aR,5S,8Z,9aR)-2,2-dimethyl-1,3,3a,4,5,6,7,9a-octahydrocyclopenta[8]annulen-5-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,5S,8Z,9aR)-2,2-dimethyl-1,3,3a,4,5,6,7,9a-octahydrocyclopenta[8]annulen-5-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101467150 |
| Molecular Formula | C19H36OSi |
| Molecular Weight | 308.58 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | [(3aR,5S,8Z,9aR)-2,2-dimethyl-1,3,3a,4,5,6,7,9a-octahydrocyclopenta[8]annulen-5-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)C[C@@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)CC/C=C\[C@@H]2C1 |
| InChI | InChI=1S/C19H36OSi/c1-18(2,3)21(6,7)20-17-11-9-8-10-15-13-19(4,5)14-16(15)12-17/h8,10,15-17H,9,11-14H2,1-7H3/b10-8-/t15-,16+,17+/m1/s1 |
| InChIKey | UQIFDDLXRYKDLK-UQLZKREUSA-N |
| XLogP | 6.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|