C21H42OSi — CID 134849881
tert-butyl-[(Z)-1-[(1S,2S)-2-ethylcyclopentyl]oct-1-en-3-yl]oxy-dimethylsilane (PubChem CID 134849881) has the molecular formula C21H42OSi and a molecular weight of 338.65 g/mol. Its IUPAC name is tert-butyl-[(Z)-1-[(1S,2S)-2-ethylcyclopentyl]oct-1-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(Z)-1-[(1S,2S)-2-ethylcyclopentyl]oct-1-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134849881 |
| Molecular Formula | C21H42OSi |
| Molecular Weight | 338.65 g/mol |
| Exact Mass | 338.30 |
| IUPAC Name | tert-butyl-[(Z)-1-[(1S,2S)-2-ethylcyclopentyl]oct-1-en-3-yl]oxy-dimethylsilane |
| SMILES | CCCCCC(/C=C\[C@H]1CCC[C@@H]1CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42OSi/c1-8-10-11-15-20(22-23(6,7)21(3,4)5)17-16-19-14-12-13-18(19)9-2/h16-20H,8-15H2,1-7H3/b17-16-/t18-,19+,20?/m0/s1 |
| InChIKey | JALZQUUMABPDAC-BBEFTVMTSA-N |
| XLogP | 7.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.65 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|