C18H36OSi — CID 99771680
tert-butyl-[[(1S,2S,3S)-2-ethenyl-1-methyl-3-propan-2-ylcyclopentyl]methoxy]-dimethylsilane (PubChem CID 99771680) has the molecular formula C18H36OSi and a molecular weight of 296.57 g/mol. Its IUPAC name is tert-butyl-[[(1S,2S,3S)-2-ethenyl-1-methyl-3-propan-2-ylcyclopentyl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,2S,3S)-2-ethenyl-1-methyl-3-propan-2-ylcyclopentyl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 99771680 |
| Molecular Formula | C18H36OSi |
| Molecular Weight | 296.57 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | tert-butyl-[[(1S,2S,3S)-2-ethenyl-1-methyl-3-propan-2-ylcyclopentyl]methoxy]-dimethylsilane |
| SMILES | C=C[C@H]1[C@H](C(C)C)CC[C@]1(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36OSi/c1-10-16-15(14(2)3)11-12-18(16,7)13-19-20(8,9)17(4,5)6/h10,14-16H,1,11-13H2,2-9H3/t15-,16-,18+/m0/s1 |
| InChIKey | UMUKCLBQTCCTKS-XYJFISCASA-N |
| XLogP | 5.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.57 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|