C29H46OSi — CID 18622635
[3-(2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl)-3-cyclopenta-1,3-dien-1-ylpentoxy]-triethylsilane (PubChem CID 18622635) has the molecular formula C29H46OSi and a molecular weight of 438.77 g/mol. Its IUPAC name is [3-(2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl)-3-cyclopenta-1,3-dien-1-ylpentoxy]-triethylsilane.
| Compound Name | [3-(2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl)-3-cyclopenta-1,3-dien-1-ylpentoxy]-triethylsilane |
|---|---|
| PubChem CID | 18622635 |
| Molecular Formula | C29H46OSi |
| Molecular Weight | 438.77 g/mol |
| Exact Mass | 438.33 |
| IUPAC Name | [3-(2,3,4,4a,4b,8a,9,9a-octahydro-1H-fluoren-9-yl)-3-cyclopenta-1,3-dien-1-ylpentoxy]-triethylsilane |
| SMILES | CCC(CCO[Si](CC)(CC)CC)(C1=CC=CC1)C1C2C=CC=CC2C2CCCCC21 |
| InChI | InChI=1S/C29H46OSi/c1-5-29(23-15-9-10-16-23,21-22-30-31(6-2,7-3)8-4)28-26-19-13-11-17-24(26)25-18-12-14-20-27(25)28/h9-11,13,15,17,19,24-28H,5-8,12,14,16,18,20-22H2,1-4H3 |
| InChIKey | IXVJVRCBPBENES-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.77 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|