C11H12N2 — CID 102480724
2-cyclopenta-2,4-dien-1-yl-4,6-dimethylpyrimidine (PubChem CID 102480724) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-cyclopenta-2,4-dien-1-yl-4,6-dimethylpyrimidine.
| Compound Name | 2-cyclopenta-2,4-dien-1-yl-4,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 102480724 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 2-cyclopenta-2,4-dien-1-yl-4,6-dimethylpyrimidine |
| SMILES | Cc1cc(C)nc(C2C=CC=C2)n1 |
| InChI | InChI=1S/C11H12N2/c1-8-7-9(2)13-11(12-8)10-5-3-4-6-10/h3-7,10H,1-2H3 |
| InChIKey | RXQQZUCYUMQCKH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |