About 2-cyclopenta-2,4-dien-1-yl-4,6-dimethylpyrimidine
2-cyclopenta-2,4-dien-1-yl-4,6-dimethylpyrimidine (PubChem CID 102480724) has the molecular formula C11H12N2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-cyclopenta-2,4-dien-1-yl-4,6-dimethylpyrimidine.
Molecular Properties
| Compound Name | 2-cyclopenta-2,4-dien-1-yl-4,6-dimethylpyrimidine |
| PubChem CID | 102480724 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 2-cyclopenta-2,4-dien-1-yl-4,6-dimethylpyrimidine |
| SMILES | Cc1cc(C)nc(C2C=CC=C2)n1 |
| InChI | InChI=1S/C11H12N2/c1-8-7-9(2)13-11(12-8)10-5-3-4-6-10/h3-7,10H,1-2H3 |
| InChIKey | RXQQZUCYUMQCKH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclopenta-2,4-dien-1-yl-4,6-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopenta-2,4-dien-1-yl-4,6-dimethylpyrimidine?
The IUPAC name of 2-cyclopenta-2,4-dien-1-yl-4,6-dimethylpyrimidine (CID 102480724) is 2-cyclopenta-2,4-dien-1-yl-4,6-dimethylpyrimidine.
What is the SMILES notation for 2-cyclopenta-2,4-dien-1-yl-4,6-dimethylpyrimidine?
The canonical SMILES for 2-cyclopenta-2,4-dien-1-yl-4,6-dimethylpyrimidine is Cc1cc(C)nc(C2C=CC=C2)n1.
What is the InChIKey of 2-cyclopenta-2,4-dien-1-yl-4,6-dimethylpyrimidine?
The InChIKey is RXQQZUCYUMQCKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2/c1-8-7-9(2)13-11(12-8)10-5-3-4-6-10/h3-7,10H,1-2H3.
What are the key properties of 2-cyclopenta-2,4-dien-1-yl-4,6-dimethylpyrimidine?
2-cyclopenta-2,4-dien-1-yl-4,6-dimethylpyrimidine has a molecular weight of 172.23 g/mol, XLogP of 2.30, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopenta-2,4-dien-1-yl-4,6-dimethylpyrimidine is sourced from PubChem (CID 102480724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).