About 1,8-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene
1,8-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene (PubChem CID 154982040) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 1,8-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene.
Analyze 1,8-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene?
The IUPAC name of 1,8-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene (CID 154982040) is 1,8-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene.
What is the SMILES notation for 1,8-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene?
The canonical SMILES for 1,8-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene is CC12CCC(C)(O1)C1C=CC=CC12.
What is the InChIKey of 1,8-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene?
The InChIKey is LUTRLBMBNSAWQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c1-11-7-8-12(2,13-11)10-6-4-3-5-9(10)11/h3-6,9-10H,7-8H2,1-2H3.
What are the key properties of 1,8-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene?
1,8-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene has a molecular weight of 176.26 g/mol, XLogP of 2.69, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-3,5-diene is sourced from PubChem (CID 154982040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).