C36H36Si2 — CID 16723468
[(1S,4S)-2,3-di(fluoren-9-ylidene)-4-trimethylsilylcyclobutyl]-trimethylsilane (PubChem CID 16723468) has the molecular formula C36H36Si2 and a molecular weight of 524.86 g/mol. Its IUPAC name is [(1S,4S)-2,3-di(fluoren-9-ylidene)-4-trimethylsilylcyclobutyl]-trimethylsilane.
| Compound Name | [(1S,4S)-2,3-di(fluoren-9-ylidene)-4-trimethylsilylcyclobutyl]-trimethylsilane |
|---|---|
| PubChem CID | 16723468 |
| Molecular Formula | C36H36Si2 |
| Molecular Weight | 524.86 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | [(1S,4S)-2,3-di(fluoren-9-ylidene)-4-trimethylsilylcyclobutyl]-trimethylsilane |
| SMILES | C[Si](C)(C)[C@H]1C(=C2c3ccccc3-c3ccccc32)C(=C2c3ccccc3-c3ccccc32)[C@@H]1[Si](C)(C)C |
| InChI | InChI=1S/C36H36Si2/c1-37(2,3)35-33(31-27-19-11-7-15-23(27)24-16-8-12-20-28(24)31)34(36(35)38(4,5)6)32-29-21-13-9-17-25(29)26-18-10-14-22-30(26)32/h7-22,35-36H,1-6H3/t35-,36-/m0/s1 |
| InChIKey | VFKGKECQIVXXTR-ZPGRZCPFSA-N |
| XLogP | 10.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.86 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|