C30H18Br2 — CID 132603146
9-[(2R,3R)-2,3-dibromo-4-fluoren-9-ylidenecyclobutylidene]fluorene (PubChem CID 132603146) has the molecular formula C30H18Br2 and a molecular weight of 538.28 g/mol. Its IUPAC name is 9-[(2R,3R)-2,3-dibromo-4-fluoren-9-ylidenecyclobutylidene]fluorene.
| Compound Name | 9-[(2R,3R)-2,3-dibromo-4-fluoren-9-ylidenecyclobutylidene]fluorene |
|---|---|
| PubChem CID | 132603146 |
| Molecular Formula | C30H18Br2 |
| Molecular Weight | 538.28 g/mol |
| Exact Mass | 535.98 |
| IUPAC Name | 9-[(2R,3R)-2,3-dibromo-4-fluoren-9-ylidenecyclobutylidene]fluorene |
| SMILES | Br[C@@H]1C(=C2c3ccccc3-c3ccccc32)C(=C2c3ccccc3-c3ccccc32)[C@H]1Br |
| InChI | InChI=1S/C30H18Br2/c31-29-27(25-21-13-5-1-9-17(21)18-10-2-6-14-22(18)25)28(30(29)32)26-23-15-7-3-11-19(23)20-12-4-8-16-24(20)26/h1-16,29-30H/t29-,30-/m1/s1 |
| InChIKey | KKPFNZTXHVXQPT-LOYHVIPDSA-N |
| XLogP | 8.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.28 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|