C18H14S2 — CID 86191028
2-fluoren-9-ylidene-4,5-dimethyl-1,3-dithiole (PubChem CID 86191028) has the molecular formula C18H14S2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 2-fluoren-9-ylidene-4,5-dimethyl-1,3-dithiole.
| Compound Name | 2-fluoren-9-ylidene-4,5-dimethyl-1,3-dithiole |
|---|---|
| PubChem CID | 86191028 |
| Molecular Formula | C18H14S2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-fluoren-9-ylidene-4,5-dimethyl-1,3-dithiole |
| SMILES | CC1=C(C)SC(=C2c3ccccc3-c3ccccc32)S1 |
| InChI | InChI=1S/C18H14S2/c1-11-12(2)20-18(19-11)17-15-9-5-3-7-13(15)14-8-4-6-10-16(14)17/h3-10H,1-2H3 |
| InChIKey | SKTWTBOHMMGJGV-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |