C20H12N2S4 — CID 100929284
[10-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)anthracen-9-ylidene]cyanamide (PubChem CID 100929284) has the molecular formula C20H12N2S4 and a molecular weight of 408.60 g/mol. Its IUPAC name is [10-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)anthracen-9-ylidene]cyanamide.
| Compound Name | [10-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)anthracen-9-ylidene]cyanamide |
|---|---|
| PubChem CID | 100929284 |
| Molecular Formula | C20H12N2S4 |
| Molecular Weight | 408.60 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | [10-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)anthracen-9-ylidene]cyanamide |
| SMILES | N#CN=C1c2ccccc2C(=C2SC3=C(SCCS3)S2)c2ccccc21 |
| InChI | InChI=1S/C20H12N2S4/c21-11-22-17-14-7-3-1-5-12(14)16(13-6-2-4-8-15(13)17)18-25-19-20(26-18)24-10-9-23-19/h1-8H,9-10H2 |
| InChIKey | KOHFJIIQSBBLIO-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.60 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|