C19H14KN3OS — CID 173184377
potassium;hydride;[4-oxo-5-[[4-[(E)-2-phenylethenyl]phenyl]methylidene]-1,3-thiazolidin-2-ylidene]cyanamide (PubChem CID 173184377) has the molecular formula C19H14KN3OS and a molecular weight of 371.51 g/mol. Its IUPAC name is potassium;hydride;[4-oxo-5-[[4-[(E)-2-phenylethenyl]phenyl]methylidene]-1,3-thiazolidin-2-ylidene]cyanamide.
| Compound Name | potassium;hydride;[4-oxo-5-[[4-[(E)-2-phenylethenyl]phenyl]methylidene]-1,3-thiazolidin-2-ylidene]cyanamide |
|---|---|
| PubChem CID | 173184377 |
| Molecular Formula | C19H14KN3OS |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | potassium;hydride;[4-oxo-5-[[4-[(E)-2-phenylethenyl]phenyl]methylidene]-1,3-thiazolidin-2-ylidene]cyanamide |
| SMILES | N#C/N=C1\NC(=O)C(=Cc2ccc(/C=C/c3ccccc3)cc2)S1.[H-].[K+] |
| InChI | InChI=1S/C19H13N3OS.K.H/c20-13-21-19-22-18(23)17(24-19)12-16-10-8-15(9-11-16)7-6-14-4-2-1-3-5-14;;/h1-12H,(H,21,22,23);;/q;+1;-1/b7-6+,17-12?;; |
| InChIKey | SANFFCYNCICHDT-KVQKVFRISA-N |
| XLogP | 1.01 |
| TPSA | 65.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|