C22H17N3OS — CID 137165844
(5Z)-2-(4-anilinophenyl)imino-5-benzylidene-1,3-thiazolidin-4-one (PubChem CID 137165844) has the molecular formula C22H17N3OS and a molecular weight of 371.47 g/mol. Its IUPAC name is (5Z)-2-(4-anilinophenyl)imino-5-benzylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-anilinophenyl)imino-5-benzylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137165844 |
| Molecular Formula | C22H17N3OS |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | (5Z)-2-(4-anilinophenyl)imino-5-benzylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2ccc(Nc3ccccc3)cc2)S/C1=C\c1ccccc1 |
| InChI | InChI=1S/C22H17N3OS/c26-21-20(15-16-7-3-1-4-8-16)27-22(25-21)24-19-13-11-18(12-14-19)23-17-9-5-2-6-10-17/h1-15,23H,(H,24,25,26)/b20-15- |
| InChIKey | GTIMLNPUZXRMEA-HKWRFOASSA-N |
| XLogP | 5.32 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|