C24H22N4OS — CID 137165829
(5Z)-2-(4-anilinophenyl)imino-5-[[4-(dimethylamino)phenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137165829) has the molecular formula C24H22N4OS and a molecular weight of 414.53 g/mol. Its IUPAC name is (5Z)-2-(4-anilinophenyl)imino-5-[[4-(dimethylamino)phenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-anilinophenyl)imino-5-[[4-(dimethylamino)phenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137165829 |
| Molecular Formula | C24H22N4OS |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | (5Z)-2-(4-anilinophenyl)imino-5-[[4-(dimethylamino)phenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CN(C)c1ccc(/C=C2\S/C(=N/c3ccc(Nc4ccccc4)cc3)NC2=O)cc1 |
| InChI | InChI=1S/C24H22N4OS/c1-28(2)21-14-8-17(9-15-21)16-22-23(29)27-24(30-22)26-20-12-10-19(11-13-20)25-18-6-4-3-5-7-18/h3-16,25H,1-2H3,(H,26,27,29)/b22-16- |
| InChIKey | VDGWTODSENKJFI-JWGURIENSA-N |
| XLogP | 5.39 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|