C28H22Cl2N2S6 — CID 139119507
4-[(1Z,3Z)-3-(4-cyanophenyl)-6,14-dimethyl-5,8,12,15,16,17-hexathiatricyclo[11.2.1.14,7]heptadeca-1,3,6,13-tetraen-2-yl]benzonitrile;dichloromethane (PubChem CID 139119507) has the molecular formula C28H22Cl2N2S6 and a molecular weight of 649.81 g/mol. Its IUPAC name is 4-[(1Z,3Z)-3-(4-cyanophenyl)-6,14-dimethyl-5,8,12,15,16,17-hexathiatricyclo[11.2.1.14,7]heptadeca-1,3,6,13-tetraen-2-yl]benzonitrile;dichloromethane.
| Compound Name | 4-[(1Z,3Z)-3-(4-cyanophenyl)-6,14-dimethyl-5,8,12,15,16,17-hexathiatricyclo[11.2.1.14,7]heptadeca-1,3,6,13-tetraen-2-yl]benzonitrile;dichloromethane |
|---|---|
| PubChem CID | 139119507 |
| Molecular Formula | C28H22Cl2N2S6 |
| Molecular Weight | 649.81 g/mol |
| Exact Mass | 647.95 |
| IUPAC Name | 4-[(1Z,3Z)-3-(4-cyanophenyl)-6,14-dimethyl-5,8,12,15,16,17-hexathiatricyclo[11.2.1.14,7]heptadeca-1,3,6,13-tetraen-2-yl]benzonitrile;dichloromethane |
| SMILES | CC1=C2SCCCSC3=C(C)S/C(=C(c4ccc(C#N)cc4)/C(c4ccc(C#N)cc4)=C(/S1)S2)S3.ClCCl |
| InChI | InChI=1S/C27H20N2S6.CH2Cl2/c1-16-24-30-12-3-13-31-25-17(2)33-27(35-25)23(21-10-6-19(15-29)7-11-21)22(26(32-16)34-24)20-8-4-18(14-28)5-9-20;2-1-3/h4-11H,3,12-13H2,1-2H3;1H2/b26-22-,27-23-; |
| InChIKey | RUXNEEQOKSQOQP-LCGWNQRBSA-N |
| XLogP | 11.10 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.81 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|