C30H16N2 — CID 71530971
4-[4-[4-[4-(4-cyanophenyl)phenyl]buta-1,3-diynyl]phenyl]benzonitrile (PubChem CID 71530971) has the molecular formula C30H16N2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 4-[4-[4-[4-(4-cyanophenyl)phenyl]buta-1,3-diynyl]phenyl]benzonitrile.
| Compound Name | 4-[4-[4-[4-(4-cyanophenyl)phenyl]buta-1,3-diynyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 71530971 |
| Molecular Formula | C30H16N2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 4-[4-[4-[4-(4-cyanophenyl)phenyl]buta-1,3-diynyl]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(C#CC#Cc3ccc(-c4ccc(C#N)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H16N2/c31-21-25-9-17-29(18-10-25)27-13-5-23(6-14-27)3-1-2-4-24-7-15-28(16-8-24)30-19-11-26(22-32)12-20-30/h5-20H |
| InChIKey | JZKCQYKNDJGPHA-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|