C17H8ClN — CID 71697683
4-[4-(3-chlorophenyl)buta-1,3-diynyl]benzonitrile (PubChem CID 71697683) has the molecular formula C17H8ClN and a molecular weight of 261.71 g/mol. Its IUPAC name is 4-[4-(3-chlorophenyl)buta-1,3-diynyl]benzonitrile.
| Compound Name | 4-[4-(3-chlorophenyl)buta-1,3-diynyl]benzonitrile |
|---|---|
| PubChem CID | 71697683 |
| Molecular Formula | C17H8ClN |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 4-[4-(3-chlorophenyl)buta-1,3-diynyl]benzonitrile |
| SMILES | N#Cc1ccc(C#CC#Cc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C17H8ClN/c18-17-7-3-6-15(12-17)5-2-1-4-14-8-10-16(13-19)11-9-14/h3,6-12H |
| InChIKey | IDEONTWUUCVZAF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|