About 3-chlorobenzonitrile;1-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride
3-chlorobenzonitrile;1-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride (PubChem CID 159605665) has the molecular formula C16H15Cl3N2
and a molecular weight of 341.67 g/mol. Its IUPAC name is 3-chlorobenzonitrile;1-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 3-chlorobenzonitrile;1-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride |
| PubChem CID | 159605665 |
| Molecular Formula | C16H15Cl3N2 |
| Molecular Weight | 341.67 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 3-chlorobenzonitrile;1-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride |
| SMILES | Cl.N#Cc1cccc(Cl)c1.NC1(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C9H10ClN.C7H4ClN.ClH/c10-8-3-1-2-7(6-8)9(11)4-5-9;8-7-3-1-2-6(4-7)5-9;/h1-3,6H,4-5,11H2;1-4H;1H |
| InChIKey | QAQXIGPKGWEFKN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.67 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chlorobenzonitrile;1-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorobenzonitrile;1-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride?
The IUPAC name of 3-chlorobenzonitrile;1-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride (CID 159605665) is 3-chlorobenzonitrile;1-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride.
What is the SMILES notation for 3-chlorobenzonitrile;1-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride?
The canonical SMILES for 3-chlorobenzonitrile;1-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride is Cl.N#Cc1cccc(Cl)c1.NC1(c2cccc(Cl)c2)CC1.
What is the InChIKey of 3-chlorobenzonitrile;1-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride?
The InChIKey is QAQXIGPKGWEFKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClN.C7H4ClN.ClH/c10-8-3-1-2-7(6-8)9(11)4-5-9;8-7-3-1-2-6(4-7)5-9;/h1-3,6H,4-5,11H2;1-4H;1H.
What are the key properties of 3-chlorobenzonitrile;1-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride?
3-chlorobenzonitrile;1-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride has a molecular weight of 341.67 g/mol, XLogP of 4.92, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorobenzonitrile;1-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride is sourced from PubChem (CID 159605665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).