C14H13N — CID 153394358
4-(6-methylcyclohexa-1,5-dien-1-yl)benzonitrile (PubChem CID 153394358) has the molecular formula C14H13N and a molecular weight of 195.26 g/mol. Its IUPAC name is 4-(6-methylcyclohexa-1,5-dien-1-yl)benzonitrile.
| Compound Name | 4-(6-methylcyclohexa-1,5-dien-1-yl)benzonitrile |
|---|---|
| PubChem CID | 153394358 |
| Molecular Formula | C14H13N |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 4-(6-methylcyclohexa-1,5-dien-1-yl)benzonitrile |
| SMILES | CC1=CCCC=C1c1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H13N/c1-11-4-2-3-5-14(11)13-8-6-12(10-15)7-9-13/h4-9H,2-3H2,1H3 |
| InChIKey | UHHUNVRATGLMHH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |