C25H27N — CID 143368979
4-methylbenzonitrile;[(E)-prop-1-enyl]benzene;1,4-xylene (PubChem CID 143368979) has the molecular formula C25H27N and a molecular weight of 341.50 g/mol. Its IUPAC name is 4-methylbenzonitrile;[(E)-prop-1-enyl]benzene;1,4-xylene.
| Compound Name | 4-methylbenzonitrile;[(E)-prop-1-enyl]benzene;1,4-xylene |
|---|---|
| PubChem CID | 143368979 |
| Molecular Formula | C25H27N |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 4-methylbenzonitrile;[(E)-prop-1-enyl]benzene;1,4-xylene |
| SMILES | C/C=C/c1ccccc1.Cc1ccc(C#N)cc1.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C9H10.C8H7N.C8H10/c1-2-6-9-7-4-3-5-8-9;1-7-2-4-8(6-9)5-3-7;1-7-3-5-8(2)6-4-7/h2-8H,1H3;2-5H,1H3;3-6H,1-2H3/b6-2+;; |
| InChIKey | HSPBONMEFWOCKA-UKBMIWHLSA-N |
| XLogP | 6.89 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |